C19H22N4O4S — CID 175716595
2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylsulfanyl)isoindole-1,3-dione (PubChem CID 175716595) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylsulfanyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylsulfanyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175716595 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperazin-1-ylethylsulfanyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(SCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H22N4O4S/c24-15-5-4-13(17(25)21-15)23-18(26)12-2-1-3-14(16(12)19(23)27)28-11-10-22-8-6-20-7-9-22/h1-3,13,20H,4-11H2,(H,21,24,25) |
| InChIKey | CREUNIWRWXNEFD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|