C27H29N3O4S — CID 154689949
2-(2,6-dioxopiperidin-3-yl)-4-[2-[4-(piperidin-1-ylmethyl)phenyl]ethylsulfanyl]isoindole-1,3-dione (PubChem CID 154689949) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[4-(piperidin-1-ylmethyl)phenyl]ethylsulfanyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[4-(piperidin-1-ylmethyl)phenyl]ethylsulfanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154689949 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[4-(piperidin-1-ylmethyl)phenyl]ethylsulfanyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(SCCc4ccc(CN5CCCCC5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H29N3O4S/c31-23-12-11-21(25(32)28-23)30-26(33)20-5-4-6-22(24(20)27(30)34)35-16-13-18-7-9-19(10-8-18)17-29-14-2-1-3-15-29/h4-10,21H,1-3,11-17H2,(H,28,31,32) |
| InChIKey | UNPHQLQEHGLRDY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|