C26H36N4O4S — CID 175716645
2-(2,6-dioxopiperidin-3-yl)-4-(9-piperazin-1-ylnonylsulfanyl)isoindole-1,3-dione (PubChem CID 175716645) has the molecular formula C26H36N4O4S and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(9-piperazin-1-ylnonylsulfanyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(9-piperazin-1-ylnonylsulfanyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175716645 |
| Molecular Formula | C26H36N4O4S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(9-piperazin-1-ylnonylsulfanyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(SCCCCCCCCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H36N4O4S/c31-22-12-11-20(24(32)28-22)30-25(33)19-9-8-10-21(23(19)26(30)34)35-18-7-5-3-1-2-4-6-15-29-16-13-27-14-17-29/h8-10,20,27H,1-7,11-18H2,(H,28,31,32) |
| InChIKey | BKWUDKJHTRQBTJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|