C23H30N4O7 — CID 155292499
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 155292499) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155292499 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCCOCCOCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O7/c28-19-5-4-17(21(29)25-19)27-22(30)16-2-1-3-18(20(16)23(27)31)34-15-14-33-13-12-32-11-10-26-8-6-24-7-9-26/h1-3,17,24H,4-15H2,(H,25,28,29) |
| InChIKey | SSVSFGIUMLIIIF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|