C19H20N4O6 — CID 155292507
2-(2,6-dioxopiperidin-3-yl)-4-(2-oxo-2-piperazin-1-ylethoxy)isoindole-1,3-dione (PubChem CID 155292507) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-oxo-2-piperazin-1-ylethoxy)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-oxo-2-piperazin-1-ylethoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155292507 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-oxo-2-piperazin-1-ylethoxy)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCC(=O)N4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20N4O6/c24-14-5-4-12(17(26)21-14)23-18(27)11-2-1-3-13(16(11)19(23)28)29-10-15(25)22-8-6-20-7-9-22/h1-3,12,20H,4-10H2,(H,21,24,26) |
| InChIKey | KVNCASMXFPOTTA-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|