C20H22N4O6 — CID 165436323
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-piperidin-3-ylacetamide (PubChem CID 165436323) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-piperidin-3-ylacetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 165436323 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-piperidin-3-ylacetamide |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCC(=O)NC4CCCNC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22N4O6/c25-15-7-6-13(18(27)23-15)24-19(28)12-4-1-5-14(17(12)20(24)29)30-10-16(26)22-11-3-2-8-21-9-11/h1,4-5,11,13,21H,2-3,6-10H2,(H,22,26)(H,23,25,27) |
| InChIKey | RMGBXLJIRFODLS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|