C19H21ClN4O6 — CID 165436330
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride (PubChem CID 165436330) has the molecular formula C19H21ClN4O6 and a molecular weight of 436.85 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 165436330 |
| Molecular Formula | C19H21ClN4O6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[(3R)-pyrrolidin-3-yl]acetamide;hydrochloride |
| SMILES | Cl.O=C1CCC(N2C(=O)c3cccc(OCC(=O)N[C@@H]4CCNC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H20N4O6.ClH/c24-14-5-4-12(17(26)22-14)23-18(27)11-2-1-3-13(16(11)19(23)28)29-9-15(25)21-10-6-7-20-8-10;/h1-3,10,12,20H,4-9H2,(H,21,25)(H,22,24,26);1H/t10-,12?;/m1./s1 |
| InChIKey | CBESDNKVDRLEHD-CUVFJIIPSA-N |
| XLogP | -0.63 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|