C15H11IN2O6 — CID 164925007
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl iodide (PubChem CID 164925007) has the molecular formula C15H11IN2O6 and a molecular weight of 442.17 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl iodide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl iodide |
|---|---|
| PubChem CID | 164925007 |
| Molecular Formula | C15H11IN2O6 |
| Molecular Weight | 442.17 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetyl iodide |
| SMILES | O=C(I)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H11IN2O6/c16-10(19)6-24-9-3-1-2-7-12(9)15(23)18(14(7)22)8-4-5-11(20)17-13(8)21/h1-3,8H,4-6H2,(H,17,20,21) |
| InChIKey | RDRXYTPGXDOJRA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|