C17H20N2O5 — CID 166167636
2-(2,6-dioxopiperidin-3-yl)-4-ethoxyisoindole-1,3-dione;ethane (PubChem CID 166167636) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-ethoxyisoindole-1,3-dione;ethane.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-ethoxyisoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 166167636 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-ethoxyisoindole-1,3-dione;ethane |
| SMILES | CC.CCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H14N2O5.C2H6/c1-2-22-10-5-3-4-8-12(10)15(21)17(14(8)20)9-6-7-11(18)16-13(9)19;1-2/h3-5,9H,2,6-7H2,1H3,(H,16,18,19);1-2H3 |
| InChIKey | BAMVDPUCXNQICN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|