C18H18N2O8 — CID 175284105
2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]propanoic acid (PubChem CID 175284105) has the molecular formula C18H18N2O8 and a molecular weight of 390.35 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]propanoic acid.
| Compound Name | 2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]propanoic acid |
|---|---|
| PubChem CID | 175284105 |
| Molecular Formula | C18H18N2O8 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]propanoic acid |
| SMILES | CC(OCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C18H18N2O8/c1-9(18(25)26)27-7-8-28-12-4-2-3-10-14(12)17(24)20(16(10)23)11-5-6-13(21)19-15(11)22/h2-4,9,11H,5-8H2,1H3,(H,25,26)(H,19,21,22) |
| InChIKey | GHOUXKWOGHPVEO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|