C22H22N2O9 — CID 161345888
(2S)-8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-4,7-dioxooctanoic acid (PubChem CID 161345888) has the molecular formula C22H22N2O9 and a molecular weight of 458.42 g/mol. Its IUPAC name is (2S)-8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-4,7-dioxooctanoic acid.
| Compound Name | (2S)-8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-4,7-dioxooctanoic acid |
|---|---|
| PubChem CID | 161345888 |
| Molecular Formula | C22H22N2O9 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (2S)-8-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-2-methyl-4,7-dioxooctanoic acid |
| SMILES | C[C@@H](CC(=O)CCC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C22H22N2O9/c1-11(22(31)32)9-12(25)5-6-13(26)10-33-16-4-2-3-14-18(16)21(30)24(20(14)29)15-7-8-17(27)23-19(15)28/h2-4,11,15H,5-10H2,1H3,(H,31,32)(H,23,27,28)/t11-,15?/m0/s1 |
| InChIKey | MADPIJNLCQCROA-VPHXOMNUSA-N |
| XLogP | 0.50 |
| TPSA | 164.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|