C20H24ClN3O5 — CID 170701524
2-(2,6-dioxopiperidin-3-yl)-4-(2-piperidin-4-ylethoxy)isoindole-1,3-dione;hydrochloride (PubChem CID 170701524) has the molecular formula C20H24ClN3O5 and a molecular weight of 421.88 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperidin-4-ylethoxy)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperidin-4-ylethoxy)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 170701524 |
| Molecular Formula | C20H24ClN3O5 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(2-piperidin-4-ylethoxy)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(N2C(=O)c3cccc(OCCC4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H23N3O5.ClH/c24-16-5-4-14(18(25)22-16)23-19(26)13-2-1-3-15(17(13)20(23)27)28-11-8-12-6-9-21-10-7-12;/h1-3,12,14,21H,4-11H2,(H,22,24,25);1H |
| InChIKey | LDRQBRFAKJNARD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|