C21H28Cl2N4O6 — CID 155292496
2-(2,6-dioxopiperidin-3-yl)-4-[2-(2-piperazin-1-ylethoxy)ethoxy]isoindole-1,3-dione;dihydrochloride (PubChem CID 155292496) has the molecular formula C21H28Cl2N4O6 and a molecular weight of 503.38 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-(2-piperazin-1-ylethoxy)ethoxy]isoindole-1,3-dione;dihydrochloride.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-(2-piperazin-1-ylethoxy)ethoxy]isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 155292496 |
| Molecular Formula | C21H28Cl2N4O6 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-(2-piperazin-1-ylethoxy)ethoxy]isoindole-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCC(N2C(=O)c3cccc(OCCOCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H26N4O6.2ClH/c26-17-5-4-15(19(27)23-17)25-20(28)14-2-1-3-16(18(14)21(25)29)31-13-12-30-11-10-24-8-6-22-7-9-24;;/h1-3,15,22H,4-13H2,(H,23,26,27);2*1H |
| InChIKey | SELBVAWGQDCUDW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|