C24H32N4O5 — CID 155673288
2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[5-(2-piperazin-1-ylethoxy)pentyl]isoindole-1,3-dione (PubChem CID 155673288) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[5-(2-piperazin-1-ylethoxy)pentyl]isoindole-1,3-dione.
| Compound Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[5-(2-piperazin-1-ylethoxy)pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155673288 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-4-[5-(2-piperazin-1-ylethoxy)pentyl]isoindole-1,3-dione |
| SMILES | O=C1CC[C@H](N2C(=O)c3cccc(CCCCCOCCN4CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H32N4O5/c29-20-9-8-19(22(30)26-20)28-23(31)18-7-4-6-17(21(18)24(28)32)5-2-1-3-15-33-16-14-27-12-10-25-11-13-27/h4,6-7,19,25H,1-3,5,8-16H2,(H,26,29,30)/t19-/m0/s1 |
| InChIKey | ZIXFWBLFRCFIEZ-IBGZPJMESA-N |
| XLogP | 0.72 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|