C34H51N5O10 — CID 170403947
tert-butyl N-[1-[2-[3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propoxy]ethyl]piperidin-4-yl]carbamate (PubChem CID 170403947) has the molecular formula C34H51N5O10 and a molecular weight of 689.81 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propoxy]ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propoxy]ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 170403947 |
| Molecular Formula | C34H51N5O10 |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.36 |
| IUPAC Name | tert-butyl N-[1-[2-[3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]propoxy]ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCOCCCOCCOCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C34H51N5O10/c1-34(2,3)49-33(44)36-24-10-13-38(14-11-24)15-19-45-16-5-17-46-20-22-48-23-21-47-18-12-35-26-7-4-6-25-29(26)32(43)39(31(25)42)27-8-9-28(40)37-30(27)41/h4,6-7,24,27,35H,5,8-23H2,1-3H3,(H,36,44)(H,37,40,41) |
| InChIKey | JITNXPKLYSBFFX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 174.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|