C40H39FN4O4 — CID 168871593
3-[7-fluoro-6-[[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168871593) has the molecular formula C40H39FN4O4 and a molecular weight of 658.77 g/mol. Its IUPAC name is 3-[7-fluoro-6-[[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-fluoro-6-[[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168871593 |
| Molecular Formula | C40H39FN4O4 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | 3-[7-fluoro-6-[[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(CN4CCN(c5ccc([C@@H]6c7ccc(O)cc7CC[C@@H]6c6ccccc6)cc5)CC4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H39FN4O4/c41-38-28(9-14-33-34(38)24-45(40(33)49)35-16-17-36(47)42-39(35)48)23-43-18-20-44(21-19-43)29-10-6-26(7-11-29)37-31(25-4-2-1-3-5-25)13-8-27-22-30(46)12-15-32(27)37/h1-7,9-12,14-15,22,31,35,37,46H,8,13,16-21,23-24H2,(H,42,47,48)/t31-,35?,37+/m1/s1 |
| InChIKey | VTZUQKAMCOWTLQ-YSDKCGLOSA-N |
| XLogP | 5.48 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|