C44H46F2N4O5 — CID 146606145
3-[6-[4-[4,4-difluoro-5-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146606145) has the molecular formula C44H46F2N4O5 and a molecular weight of 748.87 g/mol. Its IUPAC name is 3-[6-[4-[4,4-difluoro-5-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[4,4-difluoro-5-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146606145 |
| Molecular Formula | C44H46F2N4O5 |
| Molecular Weight | 748.87 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | 3-[6-[4-[4,4-difluoro-5-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(CCCC(F)(F)COc5ccc(C6c7ccc(O)cc7CCC6c6ccccc6)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H46F2N4O5/c45-44(46,28-55-35-12-7-30(8-13-35)41-36(29-5-2-1-3-6-29)14-9-31-26-34(51)11-16-37(31)41)19-4-20-48-21-23-49(24-22-48)33-10-15-38-32(25-33)27-50(43(38)54)39-17-18-40(52)47-42(39)53/h1-3,5-8,10-13,15-16,25-26,36,39,41,51H,4,9,14,17-24,27-28H2,(H,47,52,53) |
| InChIKey | DLOJSADPWFQRKI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.87 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|