C45H50N4O4 — CID 160809382
5-[4-[5-[3-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 160809382) has the molecular formula C45H50N4O4 and a molecular weight of 710.92 g/mol. Its IUPAC name is 5-[4-[5-[3-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 5-[4-[5-[3-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 160809382 |
| Molecular Formula | C45H50N4O4 |
| Molecular Weight | 710.92 g/mol |
| Exact Mass | 710.38 |
| IUPAC Name | 5-[4-[5-[3-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(N4CCN(CCCCCOc5cccc([C@@H]6c7ccc(O)cc7CC[C@@H]6c6ccccc6)c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C45H50N4O4/c1-31-13-20-42(44(51)46-31)49-30-35-27-36(15-18-41(35)45(49)52)48-24-22-47(23-25-48)21-6-3-7-26-53-38-12-8-11-34(29-38)43-39(32-9-4-2-5-10-32)17-14-33-28-37(50)16-19-40(33)43/h2,4-5,8-12,15-16,18-19,27-29,39,42-43,50H,1,3,6-7,13-14,17,20-26,30H2,(H,46,51)/t39-,42?,43+/m1/s1 |
| InChIKey | MTCOUYMYSUZKMB-QUJBWPCRSA-N |
| XLogP | 7.37 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.92 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|