C43H46N4O6 — CID 155196556
3-[6-[5-[4-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155196556) has the molecular formula C43H46N4O6 and a molecular weight of 714.86 g/mol. Its IUPAC name is 3-[6-[5-[4-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155196556 |
| Molecular Formula | C43H46N4O6 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | 3-[6-[5-[4-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCN4CCN(c5ccc([C@@H]6c7ccc(O)cc7OC[C@@H]6c6ccccc6)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C43H46N4O6/c48-33-13-15-36-39(26-33)53-28-37(29-7-3-1-4-8-29)41(36)30-9-11-32(12-10-30)46-22-20-45(21-23-46)19-5-2-6-24-52-34-14-16-35-31(25-34)27-47(43(35)51)38-17-18-40(49)44-42(38)50/h1,3-4,7-16,25-26,37-38,41,48H,2,5-6,17-24,27-28H2,(H,44,49,50)/t37-,38?,41-/m1/s1 |
| InChIKey | ZYZPEZYVAYPTTN-OJXHMOJOSA-N |
| XLogP | 5.83 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|