C44H47FN4O6 — CID 166661910
3-[6-[4-[5-[4-[(3S)-3-(4-fluoro-2-methylphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166661910) has the molecular formula C44H47FN4O6 and a molecular weight of 746.88 g/mol. Its IUPAC name is 3-[6-[4-[5-[4-[(3S)-3-(4-fluoro-2-methylphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[5-[4-[(3S)-3-(4-fluoro-2-methylphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166661910 |
| Molecular Formula | C44H47FN4O6 |
| Molecular Weight | 746.88 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | 3-[6-[4-[5-[4-[(3S)-3-(4-fluoro-2-methylphenyl)-7-hydroxy-3,4-dihydro-2H-chromen-4-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(F)ccc1[C@H]1COc2cc(O)ccc2C1c1ccc(OCCCCCN2CCN(c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C44H47FN4O6/c1-28-23-31(45)7-12-35(28)38-27-55-40-25-33(50)9-14-37(40)42(38)29-5-10-34(11-6-29)54-22-4-2-3-17-47-18-20-48(21-19-47)32-8-13-36-30(24-32)26-49(44(36)53)39-15-16-41(51)46-43(39)52/h5-14,23-25,38-39,42,50H,2-4,15-22,26-27H2,1H3,(H,46,51,52)/t38-,39?,42?/m1/s1 |
| InChIKey | UNHPGLZGNNOMPH-RMBUTOMPSA-N |
| XLogP | 6.28 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.88 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|