C35H30N2O5 — CID 159898892
3-[6-[[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 159898892) has the molecular formula C35H30N2O5 and a molecular weight of 558.63 g/mol. Its IUPAC name is 3-[6-[[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 159898892 |
| Molecular Formula | C35H30N2O5 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 3-[6-[[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenyl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(Cc4ccc([C@@H]5c6ccc(O)cc6OC[C@@H]5c5ccccc5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H30N2O5/c38-26-11-13-28-31(18-26)42-20-29(23-4-2-1-3-5-23)33(28)24-9-6-21(7-10-24)16-22-8-12-27-25(17-22)19-37(35(27)41)30-14-15-32(39)36-34(30)40/h1-13,17-18,29-30,33,38H,14-16,19-20H2,(H,36,39,40)/t29-,30?,33-/m1/s1 |
| InChIKey | WOJBOIZAORHZLY-FHQKHFISSA-N |
| XLogP | 5.05 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|