C44H50N4O5 — CID 142367305
3-[6-[5-[4-[4-(2-cyclohexa-1,5-dien-1-yl-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 142367305) has the molecular formula C44H50N4O5 and a molecular weight of 714.91 g/mol. Its IUPAC name is 3-[6-[5-[4-[4-(2-cyclohexa-1,5-dien-1-yl-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-[4-(2-cyclohexa-1,5-dien-1-yl-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142367305 |
| Molecular Formula | C44H50N4O5 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.38 |
| IUPAC Name | 3-[6-[5-[4-[4-(2-cyclohexa-1,5-dien-1-yl-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]piperazin-1-yl]pentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCN4CCN(c5ccc(C6c7ccc(O)cc7CCC6C6=CCCC=C6)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H50N4O5/c49-35-14-17-38-32(27-35)11-16-37(30-7-3-1-4-8-30)42(38)31-9-12-34(13-10-31)47-24-22-46(23-25-47)21-5-2-6-26-53-36-15-18-39-33(28-36)29-48(44(39)52)40-19-20-41(50)45-43(40)51/h3,7-10,12-15,17-18,27-28,37,40,42,49H,1-2,4-6,11,16,19-26,29H2,(H,45,50,51) |
| InChIKey | ZJFAWERWMLFKKX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|