C41H34N2O6 — CID 167241743
(3S)-3-[6-[6-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]hexa-2,4-diynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167241743) has the molecular formula C41H34N2O6 and a molecular weight of 650.73 g/mol. Its IUPAC name is (3S)-3-[6-[6-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]hexa-2,4-diynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[6-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]hexa-2,4-diynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167241743 |
| Molecular Formula | C41H34N2O6 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | (3S)-3-[6-[6-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]hexa-2,4-diynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc(OCC#CC#CCOc4ccc(C5c6ccc(O)cc6CCC5c5ccccc5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C41H34N2O6/c44-31-13-18-35-29(24-31)12-17-34(27-8-4-3-5-9-27)39(35)28-10-14-32(15-11-28)48-22-6-1-2-7-23-49-33-16-19-36-30(25-33)26-43(41(36)47)37-20-21-38(45)42-40(37)46/h3-5,8-11,13-16,18-19,24-25,34,37,39,44H,12,17,20-23,26H2,(H,42,45,46)/t34?,37-,39?/m0/s1 |
| InChIKey | RDJKMCOAWRVDOA-WOFSEJRHSA-N |
| XLogP | 5.48 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|