C40H40N2O6 — CID 158149301
5-[2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]ethoxy]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one (PubChem CID 158149301) has the molecular formula C40H40N2O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is 5-[2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]ethoxy]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one.
| Compound Name | 5-[2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]ethoxy]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 158149301 |
| Molecular Formula | C40H40N2O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | 5-[2-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethoxy]ethoxy]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one |
| SMILES | C=C1CC[C@H](N2Cc3cc(OCCOCCOc4ccc([C@@H]5c6ccc(O)cc6CC[C@@H]5c5ccccc5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H40N2O6/c1-26-7-18-37(39(44)41-26)42-25-30-24-33(14-17-36(30)40(42)45)48-22-20-46-19-21-47-32-12-8-28(9-13-32)38-34(27-5-3-2-4-6-27)15-10-29-23-31(43)11-16-35(29)38/h2-6,8-9,11-14,16-17,23-24,34,37-38,43H,1,7,10,15,18-22,25H2,(H,41,44)/t34-,37+,38+/m1/s1 |
| InChIKey | RKLNLDHAAPONJC-FTMYYPKXSA-N |
| XLogP | 6.48 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|