C46H45N3O4 — CID 158149303
5-[4-[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]phenyl]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one (PubChem CID 158149303) has the molecular formula C46H45N3O4 and a molecular weight of 703.88 g/mol. Its IUPAC name is 5-[4-[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]phenyl]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one.
| Compound Name | 5-[4-[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]phenyl]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 158149303 |
| Molecular Formula | C46H45N3O4 |
| Molecular Weight | 703.88 g/mol |
| Exact Mass | 703.34 |
| IUPAC Name | 5-[4-[4-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]butylamino]phenyl]-2-[(3S)-6-methylidene-2-oxopiperidin-3-yl]-3H-isoindol-1-one |
| SMILES | C=C1CC[C@H](N2Cc3cc(-c4ccc(NCCCCOc5ccc([C@@H]6c7ccc(O)cc7CC[C@@H]6c6ccccc6)cc5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C46H45N3O4/c1-30-9-24-43(45(51)48-30)49-29-36-27-34(14-22-42(36)46(49)52)31-10-16-37(17-11-31)47-25-5-6-26-53-39-19-12-33(13-20-39)44-40(32-7-3-2-4-8-32)21-15-35-28-38(50)18-23-41(35)44/h2-4,7-8,10-14,16-20,22-23,27-28,40,43-44,47,50H,1,5-6,9,15,21,24-26,29H2,(H,48,51)/t40-,43+,44+/m1/s1 |
| InChIKey | POYYWDJXSLKHSG-ANXVSDTMSA-N |
| XLogP | 8.94 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.88 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|