C44H48N4O5 — CID 134582405
3-[6-[2-[1-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidin-4-yl]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134582405) has the molecular formula C44H48N4O5 and a molecular weight of 712.89 g/mol. Its IUPAC name is 3-[6-[2-[1-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidin-4-yl]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[1-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidin-4-yl]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134582405 |
| Molecular Formula | C44H48N4O5 |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | 3-[6-[2-[1-[2-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]ethyl]piperidin-4-yl]ethylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(NCCC4CCN(CCOc5ccc([C@@H]6c7ccc(O)cc7CC[C@@H]6c6ccccc6)cc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H48N4O5/c49-35-10-15-38-32(27-35)8-13-37(30-4-2-1-3-5-30)42(38)31-6-11-36(12-7-31)53-25-24-47-22-19-29(20-23-47)18-21-45-34-9-14-39-33(26-34)28-48(44(39)52)40-16-17-41(50)46-43(40)51/h1-7,9-12,14-15,26-27,29,37,40,42,45,49H,8,13,16-25,28H2,(H,46,50,51)/t37-,40?,42+/m1/s1 |
| InChIKey | RMQXNSAIWMZJSJ-HWDLFVQOSA-N |
| XLogP | 6.61 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|