C47H51N5O4 — CID 142368408
3-[6-[4-[7-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]-7-azaspiro[3.5]nonan-2-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 142368408) has the molecular formula C47H51N5O4 and a molecular weight of 749.96 g/mol. Its IUPAC name is 3-[6-[4-[7-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]-7-azaspiro[3.5]nonan-2-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[7-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]-7-azaspiro[3.5]nonan-2-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142368408 |
| Molecular Formula | C47H51N5O4 |
| Molecular Weight | 749.96 g/mol |
| Exact Mass | 749.39 |
| IUPAC Name | 3-[6-[4-[7-[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]-7-azaspiro[3.5]nonan-2-yl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(C5CC6(CCN(c7ccc(C8c9ccc(O)cc9CCC8c8ccccc8)cc7)CC6)C5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H51N5O4/c53-38-12-15-40-33(27-38)8-13-39(31-4-2-1-3-5-31)44(40)32-6-9-35(10-7-32)49-20-18-47(19-21-49)28-37(29-47)51-24-22-50(23-25-51)36-11-14-41-34(26-36)30-52(46(41)56)42-16-17-43(54)48-45(42)55/h1-7,9-12,14-15,26-27,37,39,42,44,53H,8,13,16-25,28-30H2,(H,48,54,55) |
| InChIKey | ZBNHSSRODJHXLX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.96 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|