C45H49N3O10 — CID 175813266
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]-1-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 175813266) has the molecular formula C45H49N3O10 and a molecular weight of 791.90 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]-1-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]-1-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175813266 |
| Molecular Formula | C45H49N3O10 |
| Molecular Weight | 791.90 g/mol |
| Exact Mass | 791.34 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-(2-ethoxyethoxy)ethoxy]-1-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | CCOCCOCCOCC(OCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)Oc1ccc(/C(=C(/CC)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C45H49N3O10/c1-3-35(30-9-6-5-7-10-30)41(31-13-17-33(49)18-14-31)32-15-19-34(20-16-32)58-40(29-56-28-27-55-26-25-54-4-2)57-24-23-46-37-12-8-11-36-42(37)45(53)48(44(36)52)38-21-22-39(50)47-43(38)51/h5-20,38,40,46,49H,3-4,21-29H2,1-2H3,(H,47,50,51)/b41-35- |
| InChIKey | LNKFFDMNODDKRV-LCNSVZBRSA-N |
| XLogP | 6.07 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.90 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|