C26H28N6O9 — CID 164762824
2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethylcarbamic acid (PubChem CID 164762824) has the molecular formula C26H28N6O9 and a molecular weight of 568.54 g/mol. Its IUPAC name is 2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 164762824 |
| Molecular Formula | C26H28N6O9 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethylcarbamic acid |
| SMILES | COc1cc(/N=N/c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc(OC)c1OCC(=O)NCCNC(=O)O |
| InChI | InChI=1S/C26H28N6O9/c1-39-19-10-14(11-20(40-2)23(19)41-13-22(34)27-8-9-28-26(37)38)30-31-17-5-3-4-15-16(17)12-32(25(15)36)18-6-7-21(33)29-24(18)35/h3-5,10-11,18,28H,6-9,12-13H2,1-2H3,(H,27,34)(H,37,38)(H,29,33,35)/b31-30+ |
| InChIKey | VMXPJQRYBZDHKG-NVQSTNCTSA-N |
| XLogP | 1.64 |
| TPSA | 197.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|