C30H36N6O9 — CID 164762845
tert-butyl N-[2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethyl]carbamate (PubChem CID 164762845) has the molecular formula C30H36N6O9 and a molecular weight of 624.65 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 164762845 |
| Molecular Formula | C30H36N6O9 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | tert-butyl N-[2-[[2-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]diazenyl]-2,6-dimethoxyphenoxy]acetyl]amino]ethyl]carbamate |
| SMILES | COc1cc(/N=N/c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc(OC)c1OCC(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H36N6O9/c1-30(2,3)45-29(41)32-12-11-31-25(38)16-44-26-22(42-4)13-17(14-23(26)43-5)34-35-20-8-6-7-18-19(20)15-36(28(18)40)21-9-10-24(37)33-27(21)39/h6-8,13-14,21H,9-12,15-16H2,1-5H3,(H,31,38)(H,32,41)(H,33,37,39)/b35-34+ |
| InChIKey | BNALPZANTLRVTG-XAHDOWKMSA-N |
| XLogP | 2.90 |
| TPSA | 186.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|