C23H32N4O5 — CID 170701960
tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-methylamino]butyl]carbamate (PubChem CID 170701960) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 170701960 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-methylamino]butyl]carbamate |
| SMILES | CN(CCCCNC(=O)OC(C)(C)C)c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H32N4O5/c1-23(2,3)32-22(31)24-12-5-6-13-26(4)17-9-7-8-15-16(17)14-27(21(15)30)18-10-11-19(28)25-20(18)29/h7-9,18H,5-6,10-14H2,1-4H3,(H,24,31)(H,25,28,29) |
| InChIKey | KJWQWZWTCAHUOC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|