C24H31N3O5 — CID 171809427
tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cyclobutyl]ethyl]carbamate (PubChem CID 171809427) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cyclobutyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cyclobutyl]ethyl]carbamate |
|---|---|
| PubChem CID | 171809427 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl N-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]cyclobutyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CC(c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C24H31N3O5/c1-24(2,3)32-23(31)25-10-9-14-11-15(12-14)16-5-4-6-17-18(16)13-27(22(17)30)19-7-8-20(28)26-21(19)29/h4-6,14-15,19H,7-13H2,1-3H3,(H,25,31)(H,26,28,29) |
| InChIKey | GFQAKAITMNUKIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|