C24H31FN4O5 — CID 170702237
tert-butyl N-[(1R,2R,4R)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-fluorocyclohexyl]carbamate (PubChem CID 170702237) has the molecular formula C24H31FN4O5 and a molecular weight of 474.53 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,4R)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-fluorocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,4R)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-fluorocyclohexyl]carbamate |
|---|---|
| PubChem CID | 170702237 |
| Molecular Formula | C24H31FN4O5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | tert-butyl N-[(1R,2R,4R)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2-fluorocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)C[C@H]1F |
| InChI | InChI=1S/C24H31FN4O5/c1-24(2,3)34-23(33)27-18-8-7-13(11-16(18)25)26-17-6-4-5-14-15(17)12-29(22(14)32)19-9-10-20(30)28-21(19)31/h4-6,13,16,18-19,26H,7-12H2,1-3H3,(H,27,33)(H,28,30,31)/t13-,16-,18-,19?/m1/s1 |
| InChIKey | WBWHEWSQVYAGOY-LUCNSGGSSA-N |
| XLogP | 2.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|