C20H24N4O5 — CID 174190318
[3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]cyclohexyl]carbamic acid (PubChem CID 174190318) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is [3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]cyclohexyl]carbamic acid.
| Compound Name | [3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174190318 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCCC(Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H24N4O5/c25-17-8-7-16(18(26)23-17)24-10-14-13(19(24)27)5-2-6-15(14)21-11-3-1-4-12(9-11)22-20(28)29/h2,5-6,11-12,16,21-22H,1,3-4,7-10H2,(H,28,29)(H,23,25,26) |
| InChIKey | ALXNVKQAAOYVHH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|