C22H28F2N4O5 — CID 170702100
tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2,2-difluorobutyl]carbamate (PubChem CID 170702100) has the molecular formula C22H28F2N4O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2,2-difluorobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2,2-difluorobutyl]carbamate |
|---|---|
| PubChem CID | 170702100 |
| Molecular Formula | C22H28F2N4O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-2,2-difluorobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)(F)CCNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H28F2N4O5/c1-21(2,3)33-20(32)26-12-22(23,24)9-10-25-15-6-4-5-13-14(15)11-28(19(13)31)16-7-8-17(29)27-18(16)30/h4-6,16,25H,7-12H2,1-3H3,(H,26,32)(H,27,29,30) |
| InChIKey | TUCPVSPNIRLHFM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|