C28H40N6O6 — CID 178109880
tert-butyl N-[5-amino-6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]-6-oxohexyl]carbamate (PubChem CID 178109880) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is tert-butyl N-[5-amino-6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 178109880 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | tert-butyl N-[5-amino-6-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]piperazin-1-yl]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N)C(=O)N1CCN(c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H40N6O6/c1-28(2,3)40-27(39)30-12-5-4-8-20(29)26(38)33-15-13-32(14-16-33)21-9-6-7-18-19(21)17-34(25(18)37)22-10-11-23(35)31-24(22)36/h6-7,9,20,22H,4-5,8,10-17,29H2,1-3H3,(H,30,39)(H,31,35,36) |
| InChIKey | TWDQOAXHYYNSCW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|