C26H36N4O6 — CID 175891825
tert-butyl N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]heptyl]carbamate (PubChem CID 175891825) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is tert-butyl N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]heptyl]carbamate |
|---|---|
| PubChem CID | 175891825 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | tert-butyl N-[7-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carbonyl]amino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNC(=O)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H36N4O6/c1-26(2,3)36-25(35)28-14-8-6-4-5-7-13-27-22(32)17-9-10-19-18(15-17)16-30(24(19)34)20-11-12-21(31)29-23(20)33/h9-10,15,20H,4-8,11-14,16H2,1-3H3,(H,27,32)(H,28,35)(H,29,31,33) |
| InChIKey | DSFKAIXMNBWCES-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|