C21H21N5O4 — CID 166429666
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 166429666) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 166429666 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)N=N1 |
| InChI | InChI=1S/C21H21N5O4/c1-2-3-8-21(24-25-21)9-10-22-18(28)13-4-5-15-14(11-13)12-26(20(15)30)16-6-7-17(27)23-19(16)29/h1,4-5,11,16H,3,6-10,12H2,(H,22,28)(H,23,27,29) |
| InChIKey | RKOVAZXYKUZITK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|