C34H49N3O4 — CID 167231206
N-[(S)-cyclodecyl(cyclononyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 167231206) has the molecular formula C34H49N3O4 and a molecular weight of 563.78 g/mol. Its IUPAC name is N-[(S)-cyclodecyl(cyclononyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[(S)-cyclodecyl(cyclononyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167231206 |
| Molecular Formula | C34H49N3O4 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | N-[(S)-cyclodecyl(cyclononyl)methyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)N[C@H](C4CCCCCCCCC4)C4CCCCCCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C34H49N3O4/c38-30-21-20-29(33(40)35-30)37-23-27-22-26(18-19-28(27)34(37)41)32(39)36-31(25-16-12-8-4-5-9-13-17-25)24-14-10-6-2-1-3-7-11-15-24/h18-19,22,24-25,29,31H,1-17,20-21,23H2,(H,36,39)(H,35,38,40)/t29?,31-/m1/s1 |
| InChIKey | AAODZAHVLVZZJI-ZGVDRVBQSA-N |
| XLogP | 6.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|