C22H25F3N4O6 — CID 166425873
N-[(3S)-azepan-3-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166425873) has the molecular formula C22H25F3N4O6 and a molecular weight of 498.46 g/mol. Its IUPAC name is N-[(3S)-azepan-3-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3S)-azepan-3-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166425873 |
| Molecular Formula | C22H25F3N4O6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[(3S)-azepan-3-yl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CCC(N2Cc3cc(C(=O)N[C@H]4CCCCNC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H24N4O4.C2HF3O2/c25-17-7-6-16(19(27)23-17)24-11-13-9-12(4-5-15(13)20(24)28)18(26)22-14-3-1-2-8-21-10-14;3-2(4,5)1(6)7/h4-5,9,14,16,21H,1-3,6-8,10-11H2,(H,22,26)(H,23,25,27);(H,6,7)/t14-,16?;/m0./s1 |
| InChIKey | XFZTYQVFRVUSEW-HBYWCBEISA-N |
| XLogP | 0.95 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|