C22H16F5N3O4 — CID 155338801
N-[1-(3,4-difluorophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide (PubChem CID 155338801) has the molecular formula C22H16F5N3O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155338801 |
| Molecular Formula | C22H16F5N3O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2,2,2-trifluoroethyl]-2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)NC(c4ccc(F)c(F)c4)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H16F5N3O4/c23-14-4-2-10(8-15(14)24)18(22(25,26)27)29-19(32)11-1-3-13-12(7-11)9-30(21(13)34)16-5-6-17(31)28-20(16)33/h1-4,7-8,16,18H,5-6,9H2,(H,29,32)(H,28,31,33) |
| InChIKey | WARIQOXSKBDFCQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|