C26H25F3N4O5 — CID 155338686
2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(2-morpholin-4-ylphenyl)ethyl]-3H-isoindole-5-carboxamide (PubChem CID 155338686) has the molecular formula C26H25F3N4O5 and a molecular weight of 530.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(2-morpholin-4-ylphenyl)ethyl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(2-morpholin-4-ylphenyl)ethyl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155338686 |
| Molecular Formula | C26H25F3N4O5 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[2,2,2-trifluoro-1-(2-morpholin-4-ylphenyl)ethyl]-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)NC(c4ccccc4N4CCOCC4)C(F)(F)F)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H25F3N4O5/c27-26(28,29)22(18-3-1-2-4-19(18)32-9-11-38-12-10-32)31-23(35)15-5-6-17-16(13-15)14-33(25(17)37)20-7-8-21(34)30-24(20)36/h1-6,13,20,22H,7-12,14H2,(H,31,35)(H,30,34,36) |
| InChIKey | MKSIGNYBDFIXTO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|