C24H20F3N3O4 — CID 155732541
2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enyl]-3H-isoindole-5-carboxamide (PubChem CID 155732541) has the molecular formula C24H20F3N3O4 and a molecular weight of 471.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enyl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enyl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 155732541 |
| Molecular Formula | C24H20F3N3O4 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[(E)-4,4,4-trifluoro-1-phenylbut-2-enyl]-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)NC(/C=C/C(F)(F)F)c4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H20F3N3O4/c25-24(26,27)11-10-18(14-4-2-1-3-5-14)28-21(32)15-6-7-17-16(12-15)13-30(23(17)34)19-8-9-20(31)29-22(19)33/h1-7,10-12,18-19H,8-9,13H2,(H,28,32)(H,29,31,33)/b11-10+ |
| InChIKey | TZQSSFRYNPJFHV-ZHACJKMWSA-N |
| XLogP | 3.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|