C19H21N3O6 — CID 166426009
3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 166426009) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 166426009 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CNC(=O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2)C(=O)O |
| InChI | InChI=1S/C19H21N3O6/c1-19(2,18(27)28)9-20-15(24)10-3-4-11-8-22(17(26)12(11)7-10)13-5-6-14(23)21-16(13)25/h3-4,7,13H,5-6,8-9H2,1-2H3,(H,20,24)(H,27,28)(H,21,23,25) |
| InChIKey | CTCLFLJMOFAZCH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|