C23H25N3O4S — CID 166425717
N-[(5-tert-butylthiophen-2-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 166425717) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 166425717 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)s1 |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2,3)18-8-6-15(31-18)11-24-20(28)13-4-5-14-12-26(22(30)16(14)10-13)17-7-9-19(27)25-21(17)29/h4-6,8,10,17H,7,9,11-12H2,1-3H3,(H,24,28)(H,25,27,29) |
| InChIKey | XJIAVDQFVXXUPK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|