C21H18FN3O5 — CID 177262491
N-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3-hydroxybenzamide (PubChem CID 177262491) has the molecular formula C21H18FN3O5 and a molecular weight of 411.39 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3-hydroxybenzamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 177262491 |
| Molecular Formula | C21H18FN3O5 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]-3-hydroxybenzamide |
| SMILES | O=C1CCC(N2Cc3cc(CNC(=O)c4cccc(O)c4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H18FN3O5/c22-16-8-15-13(10-25(21(15)30)17-4-5-18(27)24-20(17)29)6-12(16)9-23-19(28)11-2-1-3-14(26)7-11/h1-3,6-8,17,26H,4-5,9-10H2,(H,23,28)(H,24,27,29) |
| InChIKey | VICRGGUJZCPZHS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|