C19H25FN2O3 — CID 170639310
3-(6-ethyl-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-methylpropane (PubChem CID 170639310) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 3-(6-ethyl-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-methylpropane.
| Compound Name | 3-(6-ethyl-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-methylpropane |
|---|---|
| PubChem CID | 170639310 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 3-(6-ethyl-5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;2-methylpropane |
| SMILES | CC(C)C.CCc1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C15H15FN2O3.C4H10/c1-2-8-5-9-7-18(15(21)10(9)6-11(8)16)12-3-4-13(19)17-14(12)20;1-4(2)3/h5-6,12H,2-4,7H2,1H3,(H,17,19,20);4H,1-3H3 |
| InChIKey | MDNBXMYFCMJRMM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|