C31H31FN4O5 — CID 171829035
3-[6-[[4-[bis(4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829035) has the molecular formula C31H31FN4O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is 3-[6-[[4-[bis(4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-[bis(4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829035 |
| Molecular Formula | C31H31FN4O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 3-[6-[[4-[bis(4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(C(c5ccc(O)cc5)c5ccc(O)cc5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H31FN4O5/c32-26-16-25-21(18-36(31(25)41)27-9-10-28(39)33-30(27)40)15-22(26)17-34-11-13-35(14-12-34)29(19-1-5-23(37)6-2-19)20-3-7-24(38)8-4-20/h1-8,15-16,27,29,37-38H,9-14,17-18H2,(H,33,39,40) |
| InChIKey | DISGIEQSCPGRIS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|