C26H28FN3O3 — CID 169309648
3-[5-fluoro-6-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309648) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[5-fluoro-6-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309648 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-[5-fluoro-6-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccccc1CN1CCC(c2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C26H28FN3O3/c1-16-4-2-3-5-18(16)14-29-10-8-17(9-11-29)20-12-19-15-30(26(33)21(19)13-22(20)27)23-6-7-24(31)28-25(23)32/h2-5,12-13,17,23H,6-11,14-15H2,1H3,(H,28,31,32) |
| InChIKey | SVFRZJSDTMLUFZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|