C28H29FN4O3 — CID 169309673
3-[5-fluoro-6-[1-[(4-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309673) has the molecular formula C28H29FN4O3 and a molecular weight of 488.56 g/mol. Its IUPAC name is 3-[5-fluoro-6-[1-[(4-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[1-[(4-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309673 |
| Molecular Formula | C28H29FN4O3 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 3-[5-fluoro-6-[1-[(4-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cccc2[nH]cc(CN3CCC(c4cc5c(cc4F)C(=O)N(C4CCC(=O)NC4=O)C5)CC3)c12 |
| InChI | InChI=1S/C28H29FN4O3/c1-16-3-2-4-23-26(16)19(13-30-23)14-32-9-7-17(8-10-32)20-11-18-15-33(28(36)21(18)12-22(20)29)24-5-6-25(34)31-27(24)35/h2-4,11-13,17,24,30H,5-10,14-15H2,1H3,(H,31,34,35) |
| InChIKey | GLKFUHXEOHIWQB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|